1,3-DINITRO-2,4-DIAMINO-BENZENE structure
|
Common Name | 1,3-DINITRO-2,4-DIAMINO-BENZENE | ||
|---|---|---|---|---|
| CAS Number | 10199-87-8 | Molecular Weight | 198.13600 | |
| Density | 1.684g/cm3 | Boiling Point | 482.481ºC at 760 mmHg | |
| Molecular Formula | C6H6N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.596ºC | |
| Name | 2,4-dinitrobenzene-1,3-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.684g/cm3 |
|---|---|
| Boiling Point | 482.481ºC at 760 mmHg |
| Molecular Formula | C6H6N4O4 |
| Molecular Weight | 198.13600 |
| Flash Point | 245.596ºC |
| Exact Mass | 198.03900 |
| PSA | 143.68000 |
| LogP | 2.87620 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.747 |
| InChIKey | XLAYMSZDBFRXOO-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])c(N)c1[N+](=O)[O-] |
| HS Code | 2921519090 |
|---|
| HS Code | 2921519090 |
|---|---|
| Summary | 2921519090. o-, m-, p-phenylenediamine, diaminotoluenes, and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4-Dinitro-m-phenylendiamin |
| 2,4-Diamino-1,3-dinitrobenzene |
| 2,4-dinitro-m-phenylenediamine |
| 2,4-dinitro-1,3-phenylenediamine |
| 1,3-Diamino-2,4-dinitro-benzol |
| 2.4-Dinitro-phenylendiamin-(1.3) |
| 1,3-DINITRO-2,4-DIAMINO-BENZENE |
| 1,3-Benzenediamine,2,4-dinitro |
| 2.4-Dinitro-1.3-diamino-benzol |