2,6-Dinitroaniline structure
|
Common Name | 2,6-Dinitroaniline | ||
|---|---|---|---|---|
| CAS Number | 606-22-4 | Molecular Weight | 183.122 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 354.5±22.0 °C at 760 mmHg | |
| Molecular Formula | C6H5N3O4 | Melting Point | 134 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 168.2±22.3 °C | |
| Symbol |
GHS06, GHS08 |
Signal Word | Danger | |
| Name | 2,6-Dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.5±22.0 °C at 760 mmHg |
| Melting Point | 134 °C (dec.)(lit.) |
| Molecular Formula | C6H5N3O4 |
| Molecular Weight | 183.122 |
| Flash Point | 168.2±22.3 °C |
| Exact Mass | 183.028000 |
| PSA | 117.66000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | QFUSCYRJMXLNRB-UHFFFAOYSA-N |
| SMILES | Nc1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| Water Solubility | practically insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H373 |
| Precautionary Statements | P261-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T+:Verytoxic; |
| Risk Phrases | R26/27/28;R33;R44 |
| Safety Phrases | S28-S37-S45-S36/37-S28A |
| RIDADR | UN 1596 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | BX9200000 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 29214210 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Preparation and NMR analysis of 2, 6-heterodifunctional halobenzenes as precursors for substituted biphenyls Sienkowska M, et al.
Tetrahedron 56(2) , 165-73, (2000)
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| MFCD00007148 |
| EINECS 210-108-1 |
| Aniline,2,6-dinitro |
| 2,6-Dinitro-anilin |
| Benzenamine,2,6-dinitro |
| 1-amino-2,5-dinitrobenzene |
| 2,6-Dinitrobenzenamine |
| 2,6-dinitro aniline |
| 2,6-Dinitroaniline |