(1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate
(1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate structure
|
Common Name | (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate | ||
|---|---|---|---|---|
| CAS Number | 102156-75-2 | Molecular Weight | 325.40200 | |
| Density | 1.164g/cm3 | Boiling Point | 415.2ºC at 760 mmHg | |
| Molecular Formula | C20H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.9ºC | |
Summary: (1-Methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate, CAS号102156-75-2, molecular formula C20H23NO3, molecular weight 325.40200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 415.2ºC at 760 mmHg |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.40200 |
| Flash Point | 204.9ºC |
| Exact Mass | 325.16800 |
| PSA | 49.77000 |
| LogP | 2.49780 |
| Vapour Pressure | 1.23E-07mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | PVTRRFZPTJJKAI-UHFFFAOYSA-N |
| SMILES | CN1CCCC1COC(=O)C(O)(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(1-methylpyrrol... CAS#:102156-75-2 |
| Literature: NOVARTIS AG; NOVARTIS PHARMA GMBH Patent: WO2005/815 A2, 2005 ; Location in patent: Page 34-35 ; WO 2005/000815 A2 |
|
~%
(1-methylpyrrol... CAS#:102156-75-2 |
| Literature: Blicke; Lu Journal of the American Chemical Society, 1955 , vol. 77, p. 29 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Pyrrolidinemethanol,1-methyl-,benzilate |
| (1-methylpyrrolidin-2-yl)methyl hydroxy(diphenyl)acetate |
| (1-Methylpyrrolid-2-yl)methyl benzilate |
| BENZILIC ACID,(1-METHYL-2-PYRROLIDINYL)METHYL ESTER |
| (+-)-benzilic acid-(1-methyl-pyrrolidin-2-ylmethyl ester) |
| Benzilsaeure-(1-methyl-pyrrolidin-2-ylmethylester) |
| BRL 485 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate? |
| A: LogP of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate is 2.49780. |
| Q: What is the Chinese name of 102156-75-2? |
| A: Chinese name of 102156-75-2 is 102156-75-2. |
| Q: What English synonyms does (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate have? |
| A: English synonyms of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate: 2-Pyrrolidinemethanol,1-methyl-,benzilate, (1-methylpyrrolidin-2-yl)methyl hydroxy(diphenyl)acetate, (1-Methylpyrrolid-2-yl)methyl benzilate, BENZILIC ACID,(1-METHYL-2-PYRROLIDINYL)METHYL ESTER, (+-)-benzilic acid-(1-methyl-pyrrolidin-2-ylmethyl ester), Benzilsaeure-(1-methyl-pyrrolidin-2-ylmethylester), BRL 485. |
| Q: What are the upstream materials of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate? |
| A: Related upstream materials(CAS) of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate: 76-89-1;34381-71-0;76-93-7. |
| Q: What is the boiling point of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate? |
| A: Boiling point of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate is 415.2ºC at 760 mmHg. |
| Q: What is the InChIKey of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate? |
| A: InChIKey of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate is PVTRRFZPTJJKAI-UHFFFAOYSA-N. |
| Q: What is the English name of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate? |
| A: The English name of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate is (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate. |
| Q: What is the polar surface area (PSA) of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate? |
| A: Polar surface area (PSA) of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate is 49.77000. |
| Q: What is the molecular formula of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate? |
| A: Molecular formula of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate is C20H23NO3. |
| Q: What is the molecular weight of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate? |
| A: Molecular weight of (1-methylpyrrolidin-2-yl)methyl 2-hydroxy-2,2-diphenylacetate is 325.40200. |