Benzenamine,N-methyl-2,4,6-trinitro- structure
|
Common Name | Benzenamine,N-methyl-2,4,6-trinitro- | ||
|---|---|---|---|---|
| CAS Number | 1022-07-7 | Molecular Weight | 242.14600 | |
| Density | 1.676g/cm3 | Boiling Point | 390.1ºC at 760mmHg | |
| Molecular Formula | C7H6N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.7ºC | |
| Name | N-Methyl-2,4,6-trinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.676g/cm3 |
|---|---|
| Boiling Point | 390.1ºC at 760mmHg |
| Molecular Formula | C7H6N4O6 |
| Molecular Weight | 242.14600 |
| Flash Point | 189.7ºC |
| Exact Mass | 242.02900 |
| PSA | 149.49000 |
| LogP | 3.09550 |
| Vapour Pressure | 2.73E-06mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | CFYAUGJHWXGWHI-UHFFFAOYSA-N |
| SMILES | CNc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2921430090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-methyl-picramine |
| N-Methylpicramide |
| N-methyl-2,4,6-trinitro-aniline |
| methyl(2,4,6-trinitrophenyl)amine |
| 1-Methylamino-2,4,6-trinitrobenzene |
| Benzenamine,N-methyl-2,4,6-trinitro |
| N-methylpicrylamine |
| 2,4,6-Trinitro-N-methyl-aniline |
| N-Methyl-2,6-trinitroaniline |