2-chloro-6-(trifluoromethyl)nicotinic acid structure
|
Common Name | 2-chloro-6-(trifluoromethyl)nicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 102243-12-9 | Molecular Weight | 231.31700 | |
| Density | 1.24 g/cm3 | Boiling Point | 462.2ºC at 760 mmHg | |
| Molecular Formula | C12H13N3S | Melting Point | 176-180ºC | |
| MSDS | N/A | Flash Point | 233.3ºC | |
| Name | 4-(4,6-dimethylpyrimidin-2-yl)sulfanylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24 g/cm3 |
|---|---|
| Boiling Point | 462.2ºC at 760 mmHg |
| Melting Point | 176-180ºC |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.31700 |
| Flash Point | 233.3ºC |
| Exact Mass | 231.08300 |
| PSA | 77.10000 |
| LogP | 3.40800 |
| InChIKey | FPLNYQRUEFPJPX-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(Sc2ccc(N)cc2)n1 |
|
~74%
2-chloro-6-(tri... CAS#:102243-12-9 |
| Literature: Jin, Chuanfei; Liang, Yong-Ju; He, Hongwu; Fu, Liwu European Journal of Medicinal Chemistry, 2011 , vol. 46, # 1 p. 429 - 432 |
|
~%
2-chloro-6-(tri... CAS#:102243-12-9 |
| Literature: US4888047 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-((4,6-DIMETHYLPYRIMIDIN-2-YL)THIO)ANILINE |
| MFCD01862658 |
| 4-(4,6-dimethyl-pyrimid-2-ylmercapto)-aniline |
| 4-(4,6-dimethylpyrimidin-2-ylthio)benzenamine |
| 2-[(4-aminophenyl)thio]-4,6-dimethylpyrimidine |