2-(4-bromophenyl)-6-methylimidazo(1,2-a& structure
|
Common Name | 2-(4-bromophenyl)-6-methylimidazo(1,2-a& | ||
|---|---|---|---|---|
| CAS Number | 1023-01-4 | Molecular Weight | 287.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11BrN2 | Melting Point | 214-218ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(4-Bromophenyl)-6-methylimidazo[1,2-a]pyridine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 214-218ºC |
|---|---|
| Molecular Formula | C14H11BrN2 |
| Molecular Weight | 287.15500 |
| Exact Mass | 286.01100 |
| PSA | 17.30000 |
| LogP | 4.07220 |
| InChIKey | OUTIKDPVXLJCLK-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(-c3ccc(Br)cc3)cn2c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~78%
2-(4-bromopheny... CAS#:1023-01-4 |
| Literature: IDEMITSU KOSAN CO., LTD. Patent: EP1582516 A1, 2005 ; Location in patent: Page/Page column 84 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-<4-Brom-phenyl>-6-methyl-imidazo<1,2-a>pyridin |