L-Ornithine,N2,N5-bis(2,4-dinitrophenyl)- structure
|
Common Name | L-Ornithine,N2,N5-bis(2,4-dinitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 10236-61-0 | Molecular Weight | 464.34300 | |
| Density | 1.651g/cm3 | Boiling Point | 788.7ºC at 760mmHg | |
| Molecular Formula | C17H16N6O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 430.8ºC | |
| Name | 2,5-bis(2,4-dinitroanilino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.651g/cm3 |
|---|---|
| Boiling Point | 788.7ºC at 760mmHg |
| Molecular Formula | C17H16N6O10 |
| Molecular Weight | 464.34300 |
| Flash Point | 430.8ºC |
| Exact Mass | 464.09300 |
| PSA | 244.64000 |
| LogP | 5.31560 |
| Vapour Pressure | 3.27E-26mmHg at 25°C |
| Index of Refraction | 1.722 |
| InChIKey | YRKUYJKLFVZPHV-UHFFFAOYSA-N |
| SMILES | O=C(O)C(CCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2922499990 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Di-DNP-L-Ornithin |