1,3,5-trinitro-2-propoxybenzene structure
|
Common Name | 1,3,5-trinitro-2-propoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 10242-24-7 | Molecular Weight | 271.18400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,5-trinitro-2-propoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9N3O7 |
|---|---|
| Molecular Weight | 271.18400 |
| Exact Mass | 271.04400 |
| PSA | 146.69000 |
| LogP | 3.76960 |
| InChIKey | FQFKHVMLVCZDTP-UHFFFAOYSA-N |
| SMILES | CCCOc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
1,3,5-trinitro-... CAS#:10242-24-7 |
| Literature: AlAruri, Ahmad D. A.; Crampton, Michael R. Journal of Chemical Research, Miniprint, 1980 , # 4 p. 2157 - 2184 |
|
~%
1,3,5-trinitro-... CAS#:10242-24-7 |
| Literature: Philbrook; Massey Journal of the American Chemical Society, 1951 , vol. 73, p. 3454 |
|
~%
1,3,5-trinitro-... CAS#:10242-24-7 |
| Literature: Cooney, Aidan; Crampton, Michael R. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 11 p. 1793 - 1796 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 1-propoxy-2,4,6-trinitrobenzene |
| n-propyl-2,4,6-trinitrophenyl ether |
| Propyl-(2.4.6-trinitro-phenyl)-aether |
| picryl-propyl ether |
| Benzene,1,3,5-trinitro-2-propoxy |
| Picryl-propyl-aether |