ethyl 8-methoxy-2-oxocyclohepta[b]furan-3-carboxylate structure
|
Common Name | ethyl 8-methoxy-2-oxocyclohepta[b]furan-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1025-12-3 | Molecular Weight | 248.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 8-methoxy-2-oxocyclohepta[b]furan-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12O5 |
|---|---|
| Molecular Weight | 248.23100 |
| Exact Mass | 248.06800 |
| PSA | 65.74000 |
| LogP | 1.92990 |
| InChIKey | DOTJTYBYSQDQSO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c2ccccc(OC)c-2oc1=O |
| HS Code | 2932209090 |
|---|
|
~%
ethyl 8-methoxy... CAS#:1025-12-3 |
| Literature: Yokota; Yanagisawa; Kosakai; Wakabayashi; Tomiyama; Yasunami Chemical and Pharmaceutical Bulletin, 1994 , vol. 42, # 4 p. 865 - 871 |
|
~%
ethyl 8-methoxy... CAS#:1025-12-3 |
| Literature: Yokota; Yanagisawa; Kosakai; Wakabayashi; Tomiyama; Yasunami Chemical and Pharmaceutical Bulletin, 1994 , vol. 42, # 4 p. 865 - 871 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 8-metoxy-2-oxo-2H-cyclohepta<b>furan-3-carboxylate |
| ethyl 8-methoxy-2-oxo-2H-cyclohepta<b>furan-3-carboxylate |
| 8-methoxy-3-ethoxycarbonyl-2H-cyclohepta<b>furan-2-one |
| 2H-Cyclohepta[b]furan-3-carboxylic acid,8-methoxy-2-oxo-,ethyl ester |
| 3-Aethoxycarbonyl-8-methoxy-1-oxa-azulan-2-on |
| 8-methoxy-2-oxo-2H-cyclohepta[b]furan-3-carboxylic acid ethyl ester |