Tropolone tosylate structure
|
Common Name | Tropolone tosylate | ||
|---|---|---|---|---|
| CAS Number | 38768-08-0 | Molecular Weight | 276.308 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 473.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H12O4S | Melting Point | 160 °C | |
| MSDS | N/A | Flash Point | 240.4±28.7 °C | |
| Name | Tropolone Tosylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 473.8±45.0 °C at 760 mmHg |
| Melting Point | 160 °C |
| Molecular Formula | C14H12O4S |
| Molecular Weight | 276.308 |
| Flash Point | 240.4±28.7 °C |
| Exact Mass | 276.045624 |
| PSA | 68.82000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | AWUMFQREGHLKJB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccccc2=O)cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2914400090 |
|
~99%
Tropolone tosylate CAS#:38768-08-0 |
| Literature: Nozoe, Tetsuo; Imafuku, Kimiaki; Yin, Bing-Zhu; Honda, Masaaki; Goto, Yasutomo; et al. Bulletin of the Chemical Society of Japan, 1988 , vol. 61, p. 2531 - 2540 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,4,6-Cycloheptatrien-1-one, 2-[[(4-methylphenyl)sulfonyl]oxy]- |
| 2-Toluenesulfonyloxytropone |
| 7-Oxocyclohepta-1,3,5-trien-1-yl 4-methylbenzenesulfonate |
| 2-Tosyloxytropone |
| Toluene-4-sulfonic acid 7-oxo-cyclohepta-1,3,5-trienyl ester |
| 7-Oxo-1,3,5-cycloheptatrienyl p-toluenesulfonate |
| (7-oxocyclohepta-1,3,5-trien-1-yl) 4-methylbenzenesulfonate |
| 7-Oxo-1,3,5-cycloheptatrien-1-yl 4-methylbenzenesulfonate |