5-(2-Fluorophenyl)cyclohexane-1,3-dione structure
|
Common Name | 5-(2-Fluorophenyl)cyclohexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 102821-72-7 | Molecular Weight | 206.21300 | |
| Density | 1.228g/cm3 | Boiling Point | 335.6ºC at 760 mmHg | |
| Molecular Formula | C12H11FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.6ºC | |
| Name | 5-(2-Fluorophenyl)cyclohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 335.6ºC at 760 mmHg |
| Molecular Formula | C12H11FO2 |
| Molecular Weight | 206.21300 |
| Flash Point | 128.6ºC |
| Exact Mass | 206.07400 |
| PSA | 34.14000 |
| LogP | 2.23140 |
| Vapour Pressure | 0.000119mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | RMEWCTHODLROAM-UHFFFAOYSA-N |
| SMILES | O=C1CC(=O)CC(c2ccccc2F)C1 |
|
~%
5-(2-Fluorophen... CAS#:102821-72-7 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 20, # 2 p. 1029 - 1045 |
|
~%
5-(2-Fluorophen... CAS#:102821-72-7 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 20, # 2 p. 1029 - 1045 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-(2-fluorophenyl)-cyclohexane-1,3-dione |
| 5-(2-fluorophenyl)-1,3-cyclohexanedione |
| 1,3-Cyclohexanedione,5-(2-fluorophenyl) |