5-(4-fluorophenyl)cyclohexane-1,3-dione structure
|
Common Name | 5-(4-fluorophenyl)cyclohexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 55579-72-1 | Molecular Weight | 206.21300 | |
| Density | 1.228 g/cm3 | Boiling Point | 353.8ºC at 760 mmHg | |
| Molecular Formula | C12H11FO2 | Melting Point | 186-189 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 135.4ºC | |
| Name | 5-(4-fluorophenyl)cyclohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.228 g/cm3 |
|---|---|
| Boiling Point | 353.8ºC at 760 mmHg |
| Melting Point | 186-189 °C(lit.) |
| Molecular Formula | C12H11FO2 |
| Molecular Weight | 206.21300 |
| Flash Point | 135.4ºC |
| Exact Mass | 206.07400 |
| PSA | 34.14000 |
| LogP | 2.23140 |
| Index of Refraction | 1.536 |
| InChIKey | LBTLJACXBCUFEF-UHFFFAOYSA-N |
| SMILES | O=C1CC(=O)CC(c2ccc(F)cc2)C1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Cyclocondensation of 3 (5)-Aminopyrazoles with Arylglyoxals and Cyclohexane-1, 3-diones. Petrova ON, et al.
Chem. Heterocycl. Comp. 49(7) , 955-967, (2013)
|
| 5-(4-Fluorophenyl)-1,3-cyclohexanedione |
| 5-(4-fluorophenyl)-cyclohexane-1,3-dione |
| MFCD00174037 |