1-(4-nitrophenyl)-2-dichloroacetamidoethane structure
|
Common Name | 1-(4-nitrophenyl)-2-dichloroacetamidoethane | ||
|---|---|---|---|---|
| CAS Number | 102904-25-6 | Molecular Weight | 277.10400 | |
| Density | 1.412g/cm3 | Boiling Point | 478.8ºC at 760mmHg | |
| Molecular Formula | C10H10Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.4ºC | |
| Name | 2,2-dichloro-N-[2-(4-nitrophenyl)ethyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 478.8ºC at 760mmHg |
| Molecular Formula | C10H10Cl2N2O3 |
| Molecular Weight | 277.10400 |
| Flash Point | 243.4ºC |
| Exact Mass | 276.00700 |
| PSA | 78.41000 |
| LogP | 3.42070 |
| Vapour Pressure | 2.5E-09mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | DUDPYHGWFFLHRW-UHFFFAOYSA-N |
| SMILES | O=C(NCCc1ccc([N+](=O)[O-])cc1)C(Cl)Cl |
|
~%
1-(4-nitropheny... CAS#:102904-25-6 |
| Literature: Rebstock et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3666,3670 Full Text Show Details Phillips Journal of the American Chemical Society, 1952 , vol. 74, p. 6125 |
|
~%
1-(4-nitropheny... CAS#:102904-25-6 |
| Literature: Rebstock et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3666,3670 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(4-Nitrophenyl)-2-dichloroacetamidoethane |
| Pno2DCAE |
| NO2DCA |
| N-(2-(4-Nitrophenethyl))dichloroacetamide |
| dichloro-acetic acid-(4-nitro-phenethylamide) |
| N-(2-Pnitrophenethyl) Dichloro Acetamide |
| Dichlor-essigsaeure-(4-nitro-phenaethylamid) |