Fmoc-Cys(Trt)-OH structure
|
Common Name | Fmoc-Cys(Trt)-OH | ||
|---|---|---|---|---|
| CAS Number | 103213-32-7 | Molecular Weight | 585.711 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 763.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C37H31NO4S | Melting Point | 170-173 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 415.5±32.9 °C | |
Use of Fmoc-Cys(Trt)-OHFmoc-Cys(Trt)-OH is a cysteine derivative[1]. |
| Name | FMOC-S-trityl-L-cysteine |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-Cys(Trt)-OH is a cysteine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 763.4±60.0 °C at 760 mmHg |
| Melting Point | 170-173 °C(lit.) |
| Molecular Formula | C37H31NO4S |
| Molecular Weight | 585.711 |
| Flash Point | 415.5±32.9 °C |
| Exact Mass | 585.197388 |
| PSA | 100.93000 |
| LogP | 9.96 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | KLBPUVPNPAJWHZ-UMSFTDKQSA-N |
| SMILES | O=C(NC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2930909090 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Hapten-directed spontaneous disulfide shuffling: a universal technology for site-directed covalent coupling of payloads to antibodies.
FASEB J. 29 , 1763-79, (2015) Humanized hapten-binding IgGs were designed with an accessible cysteine close to their binding pockets, for specific covalent payload attachment. Individual analyses of known structures of digoxigenin... |
|
|
Collagen-mimetic peptide-modifiable hydrogels for articular cartilage regeneration.
Biomaterials 54 , 213-25, (2015) Regenerative medicine strategies for restoring articular cartilage face significant challenges to recreate the complex and dynamic biochemical and biomechanical functions of native tissues. As an appr... |
|
|
Tumor-selective peptide-carrier delivery of Paclitaxel increases in vivo activity of the drug.
Sci. Rep. 5 , 17736, (2015) Taxanes are highly effective chemotherapeutic drugs against proliferating cancer and an established option in the standard treatment of ovarian and breast cancer. However, treatment with paclitaxel is... |
| Fmoc-Cys(Trt)-OH |
| (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-tritylsulfanylpropanoic acid |
| Fmoc-S-Trityl-L-Cysteine |
| N-Fmoc-S-trityl-L-cysteine |
| Cysteine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-S-(triphenylmethyl)- |
| (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-(tritylsulfanyl)propanoic acid |
| N-(9-Fluorenyl methoxy carbonyl)-S-trityl-L-cysteine |
| Na-Fmoc-Ng-trityl-L-glutamine |
| N-[(9H-Fluoren-9-ylMethoxy)carbonyl]-S-(triphenylMethyl)-L-cysteine |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-S-tritylcysteine |
| MFCD00038538 |
| 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(tritylthio)propanoic acid |