H-Gly-Leu-Phe-OH structure
|
Common Name | H-Gly-Leu-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 103213-38-3 | Molecular Weight | 335.40 | |
| Density | 1.188 g/cm3 | Boiling Point | 635.7ºC at 760 mmHg | |
| Molecular Formula | C17H25N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.3ºC | |
Use of H-Gly-Leu-Phe-OHH-Gly-Leu-Phe-OH (GLF), an immunostimulatory tripeptide derived from α-lactalbumin, inhibits anticancer agent Etoposide-induced alopecia, epidermal thickening, and thinning of the adipocyte layer[1]. |
| Name | 2-[[2-[(2-aminoacetyl)amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | H-Gly-Leu-Phe-OH (GLF), an immunostimulatory tripeptide derived from α-lactalbumin, inhibits anticancer agent Etoposide-induced alopecia, epidermal thickening, and thinning of the adipocyte layer[1]. |
|---|---|
| Related Catalog |
| Density | 1.188 g/cm3 |
|---|---|
| Boiling Point | 635.7ºC at 760 mmHg |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 |
| Flash Point | 338.3ºC |
| Exact Mass | 335.18500 |
| PSA | 121.52000 |
| LogP | 1.77020 |
| Vapour Pressure | 4.94E-17mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | TVUWMSBGMVAHSJ-KBPBESRZSA-N |
| SMILES | CC(C)CC(NC(=O)CN)C(=O)NC(Cc1ccccc1)C(=O)O |
| gly-leu-phe |
| H-GLY-LEU-PHE-OH |