(Glu1)-Fibrinopeptide B (human) structure
|
Common Name | (Glu1)-Fibrinopeptide B (human) | ||
|---|---|---|---|---|
| CAS Number | 103213-49-6 | Molecular Weight | 1570.572 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 1624.1±75.0 °C at 760 mmHg | |
| Molecular Formula | C66H95N19O26 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 936.0±37.1 °C | |
| Name | [Glu1]-Fibrinopeptide B |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 1624.1±75.0 °C at 760 mmHg |
| Molecular Formula | C66H95N19O26 |
| Molecular Weight | 1570.572 |
| Flash Point | 936.0±37.1 °C |
| Exact Mass | 1569.669556 |
| PSA | 759.13000 |
| LogP | 7.41 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.669 |
| InChIKey | KPBJTGOVJLITON-OECXYHNASA-N |
| SMILES | CC(NC(=O)C(CO)NC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(CC(N)=O)NC(=O)C(CC(=O)O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)CNC(=O)C(N)CCC(=O)O)C(C)C)C(=O)NC(CCCNC(=N)N)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
|
An integrated workflow for charting the human interaction proteome: insights into the PP2A system.
Mol. Syst. Biol. 5 , 237, (2009) Protein complexes represent major functional units for the execution of biological processes. Systematic affinity purification coupled with mass spectrometry (AP-MS) yielded a wealth of information on... |
|
|
Albumin is synthesized in epididymis and aggregates in a high molecular mass glycoprotein complex involved in sperm-egg fertilization.
PLoS ONE 9(8) , e103566, (2014) The epididymis has an important role in the maturation of sperm for fertilization, but little is known about the epididymal molecules involved in sperm modifications during this process. We have previ... |
|
|
Radioimmunoassay of human fibrinopeptide B and kinetics of fibrinopeptide cleavage by different enzymes.
J. Clin. Invest. 56(2) , 438-45, (1975) Thrombin converts fibrinogen to fibrin monomer by cleaving fibrinopeptides A and B (FPA and FPB) from the amino terminal ends of the A (alpha) and B (beta) chains. A radioimmunoassay capable of measur... |
| L-Arginine, L-α-glutamylglycyl-L-valyl-L-asparaginyl-L-α-aspartyl-L-asparaginyl-L-α-glutamyl-L-α-glutamylglycyl-L-phenylalanyl-L-phenylalanyl-L-seryl-L-alanyl- |
| L-α-Glutamylglycyl-L-valyl-L-asparaginyl-L-α-aspartyl-L-asparaginyl-L-α-glutamyl-L-α-glutamylglycyl-L-phenylalanyl-L-phenylalanyl-L-seryl-L-alanyl-L-arginine |