L-364373 structure
|
Common Name | L-364373 | ||
|---|---|---|---|---|
| CAS Number | 103342-82-1 | Molecular Weight | 397.44400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H20FN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-364373L-364,373 (R-L3) is a voltage-gated Kv7.1 (KCNQ1)/mink channels activator. L-364,373 activates Iks (slow delayed rectifier potassium current) and shortens action potential duration in guinea pig cardiac myocytes, and suppresses early afterdepolarizations in rabbit ventricular myocytes[1]. |
| Name | (3R)-5-(2-fluorophenyl)-3-(1H-indol-3-ylmethyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | L-364,373 (R-L3) is a voltage-gated Kv7.1 (KCNQ1)/mink channels activator. L-364,373 activates Iks (slow delayed rectifier potassium current) and shortens action potential duration in guinea pig cardiac myocytes, and suppresses early afterdepolarizations in rabbit ventricular myocytes[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H20FN3O |
|---|---|
| Molecular Weight | 397.44400 |
| Exact Mass | 397.15900 |
| PSA | 48.46000 |
| LogP | 4.23270 |
| InChIKey | CGBANSGENFERAT-JOCHJYFZSA-N |
| SMILES | CN1C(=O)C(Cc2c[nH]c3ccccc23)N=C(c2ccccc2F)c2ccccc21 |
| L-364,373 |
| CCK antagonist synthetic 11 |
| R-L364,373 |
| R-L3 |