(l)-n-(benzyloxycarbonyl)pipecolic acid structure
|
Common Name | (l)-n-(benzyloxycarbonyl)pipecolic acid | ||
|---|---|---|---|---|
| CAS Number | 28697-11-2 | Molecular Weight | 263.289 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 443.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H17NO4 | Melting Point | 111-115ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 222.3±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2S)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 443.9±45.0 °C at 760 mmHg |
| Melting Point | 111-115ºC(lit.) |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.289 |
| Flash Point | 222.3±28.7 °C |
| Exact Mass | 263.115753 |
| PSA | 66.84000 |
| LogP | 1.74 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | ZSAIHAKADPJIGN-LBPRGKRZSA-N |
| SMILES | O=C(O)C1CCCCN1C(=O)OCc1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2S)-1-[(Benzyloxy)carbonyl]-2-piperidinecarboxylic acid |
| 1,2-Piperidinedicarboxylic acid, 1-(phenylmethyl) ester |
| z-d-pip-oh |
| (S)-(-)-1-Cbz-2-piperidinecarboxylic acid |
| 1-[(benzyloxy)carbonyl]piperidine-2-carboxylic acid |
| (S)-1-N-Cbz-Pipecolinic acid |
| MFCD01863645 |
| 1,2-Piperidinedicarboxylic acid, 1-(phenylmethyl) ester, (2S)- |
| 1-[(Benzyloxy)carbonyl]-2-piperidinecarboxylic acid |
| (2S)-1-[(Benzyloxy)carbonyl]piperidine-2-carboxylic acid |