2,2,2-trifluoro-N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-(3-methoxyphenyl)propan-2-yl]acetamide structure
|
Common Name | 2,2,2-trifluoro-N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-(3-methoxyphenyl)propan-2-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 1034148-04-3 | Molecular Weight | 487.45 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 573.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C25H21F4N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.8±30.1 °C | |
Use of 2,2,2-trifluoro-N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-(3-methoxyphenyl)propan-2-yl]acetamideAZD5423 is an inhaled, potent, selective, and non-steroidal glucocorticoid receptor (GR) modulator (SGRM)[1]. AZD5423 effectively reduces allergen-induced responses in subjects with mild allergic asthma[2]. |
| Name | 2,2,2-trifluoro-N-[(1R,2S)-1-[1-(4-fluorophenyl)indazol-5-yl]oxy-1-(3-methoxyphenyl)propan-2-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | AZD5423 is an inhaled, potent, selective, and non-steroidal glucocorticoid receptor (GR) modulator (SGRM)[1]. AZD5423 effectively reduces allergen-induced responses in subjects with mild allergic asthma[2]. |
|---|---|
| Related Catalog | |
| Target |
Glucocorticoid receptor[1] |
| In Vitro | The affinity of AZD5423 to the glucocorticoid receptor is high with an IC50 of 0.9 nM in a radioligand human glucocorticoid receptor assay, and selectivity towards other steroid hormone receptors is >900-fold[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 573.8±50.0 °C at 760 mmHg |
| Molecular Formula | C25H21F4N3O3 |
| Molecular Weight | 487.45 |
| Flash Point | 300.8±30.1 °C |
| Exact Mass | 487.151917 |
| PSA | 68.87000 |
| LogP | 5.89 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | FCNQMDSJHADDFT-WNSKOXEYSA-N |
| SMILES | COc1cccc(C(Oc2ccc3c(cnn3-c3ccc(F)cc3)c2)C(C)NC(=O)C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|
| Acetamide, 2,2,2-trifluoro-N-[(1S,2R)-2-[[1-(4-fluorophenyl)-1H-indazol-5-yl]oxy]-2-(3-methoxyphenyl)-1-methylethyl]- |
| unii-641h0q518w |
| 2,2,2-Trifluoro-N-[(1R,2S)-1-{[1-(4-fluorophenyl)-1H-indazol-5-yl]oxy}-1-(3-methoxyphenyl)-2-propanyl]acetamide |
| AZD5423 |
| AZD-5423 |