Boc-Ser(Bzl)-OH.DCHA structure
|
Common Name | Boc-Ser(Bzl)-OH.DCHA | ||
|---|---|---|---|---|
| CAS Number | 10342-01-5 | Molecular Weight | 476.649 | |
| Density | N/A | Boiling Point | 624.7ºC at 760 mmHg | |
| Molecular Formula | C27H44N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.6ºC | |
| Name | N-cyclohexylcyclohexanamine,(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 624.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C27H44N2O5 |
| Molecular Weight | 476.649 |
| Flash Point | 331.6ºC |
| Exact Mass | 476.325012 |
| PSA | 96.89000 |
| LogP | 6.20430 |
| Vapour Pressure | 1.81E-16mmHg at 25°C |
| InChIKey | QAAQPSNBIGNDII-YDALLXLXSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)NC(COCc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| O-Benzyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serine - N-cyclohexylcyclohexanamine (1:1) |
| O-Benzyl-N-(tert-butoxycarbonyl)-L-serine - N-cyclohexylcyclohexanamine (1:1) |
| O-Benzyl-N-(tert-butoxycarbonyl)-L-serine,compound with dicyclohexylamine (1:1) |
| L-Serine, N-[(1,1-dimethylethoxy)carbonyl]-O-(phenylmethyl)-, compd. with N-cyclohexylcyclohexanamine (1:1) |
| N-tert-butoxycarbonyl-O-benzyl-L-serine dicyclohexylammonium salt |
| Boc-Ser(Bzl)-OH.DCHA |