Boc-Ser(Bzl)-ol structure
|
Common Name | Boc-Ser(Bzl)-ol | ||
|---|---|---|---|---|
| CAS Number | 79069-15-1 | Molecular Weight | 281.347 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 443.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H23NO4 | Melting Point | 66-69ºC | |
| MSDS | N/A | Flash Point | 221.8±27.3 °C | |
| Name | N-Boc-(S)-2-Amino-3-Benzyloxy-1-Propanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 443.1±40.0 °C at 760 mmHg |
| Melting Point | 66-69ºC |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.347 |
| Flash Point | 221.8±27.3 °C |
| Exact Mass | 281.162720 |
| PSA | 67.79000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | MSIDLARYVJJEQY-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)COCc1ccccc1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-2-propanyl [(2S)-1-(benzyloxy)-3-hydroxy-2-propanyl]carbamate |
| tert-butyl N-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate |
| MFCD00235944 |
| Carbamic acid, N-[(1S)-2-hydroxy-1-[(phenylmethoxy)methyl]ethyl]-, 1,1-dimethylethyl ester |
| Boc-Ser(Bzl)-ol |