Boc-Ser(Bzl)-OH structure
|
Common Name | Boc-Ser(Bzl)-OH | ||
|---|---|---|---|---|
| CAS Number | 23680-31-1 | Molecular Weight | 295.331 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 456.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO5 | Melting Point | 57-62ºC | |
| MSDS | Chinese USA | Flash Point | 229.7±28.7 °C | |
Use of Boc-Ser(Bzl)-OH(S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid is a serine derivative[1]. |
| Name | N-[(1,1-Dimethylethoxy)carbonyl]-O-(phenylmethyl)-L-serine |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid is a serine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 456.2±45.0 °C at 760 mmHg |
| Melting Point | 57-62ºC |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.331 |
| Flash Point | 229.7±28.7 °C |
| Exact Mass | 295.141968 |
| PSA | 84.86000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | DMBKPDOAQVGTST-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NC(COCc1ccccc1)C(=O)O |
| Storage condition | 2~8°C |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
|
In situ fabrication of cleavable peptide arrays on polydimethylsiloxane and applications for kinase activity assays.
Anal. Chim. Acta 865 , 53-9, (2015) Polydimethylsiloxane (PDMS) is widely used for microfabrication and bioanalysis; however, its surface functionalization is limited due to the lack of active functional groups and incompatibility with ... |
| BOC-SER-OTBU |
| Boc-L-Ser(OBzl)-OH |
| N-(tert-butyloxycarbonyl)-O-benzyl-L-serine |
| L-N-(t-butoxycarbonyl)-O-(benzyl)serine |
| O-Benzyl-N-(tert-butoxycarbonyl)-L-serine |
| BOC-SER(BU)-OH |
| (S)-3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid |
| N-(tert-Butoxycarbonyl)-O-benzyl-L-serine |
| Boc-D-Ser(Bzl)-OH |
| N-tert-butoxycarbonyl-O-benzyl-L-serine |
| Boc-Ser(Bzl)-OH |
| BOC-SER(BUT)-OH |
| BOC-Ser (Obzl) OH |
| BOC-L-SER(TBU)-OH |
| MFCD00079666 |
| L-Serine, N-[(1,1-dimethylethoxy)carbonyl]-O-(phenylmethyl)- |
| O-Benzyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-serine |
| BOC-SERINE(TBU)-OH |
| N-BOC-O-Benzyl-L-serine |
| BOC-SER(TBU)-OH |
| N-BOC-O-Benzyl-L-ser |
| (2S)-3-(Benzyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| BOC-O-BENZYL-L-SER-OH |
| EINECS 245-820-1 |
| Boc-O-benzyl-L-serine |