Methyl 4-(2-bromophenyl)-2,4-dioxobutanoate structure
|
Common Name | Methyl 4-(2-bromophenyl)-2,4-dioxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 1035235-10-9 | Molecular Weight | 285.091 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 390.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C11H9BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.0±23.7 °C | |
| Name | Methyl 4-(2-bromophenyl)-2,4-dioxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.5±27.0 °C at 760 mmHg |
| Molecular Formula | C11H9BrO4 |
| Molecular Weight | 285.091 |
| Flash Point | 190.0±23.7 °C |
| Exact Mass | 283.968414 |
| PSA | 60.44000 |
| LogP | 1.61 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | VKMVKAZSQQFHRS-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)c1ccccc1Br |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
|
~89%
Methyl 4-(2-bro... CAS#:1035235-10-9 |
| Literature: Millennium Pharmaceuticals, Inc. Patent: US2008/171754 A1, 2008 ; Location in patent: Page/Page column 97 ; US 20080171754 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzenebutanoic acid, 2-bromo-α,γ-dioxo-, methyl ester |
| Methyl 4-(2-bromophenyl)-2,4-dioxobutanoate |