Risedronic Acid-d4 structure
|
Common Name | Risedronic Acid-d4 | ||
|---|---|---|---|---|
| CAS Number | 1035438-80-2 | Molecular Weight | 287.13700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7D4NO7P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Risedronic Acid-d4Risedronic acid-d4 (Risedronate-d4) is the deuterium labeled Risedronic acid. Risedronic acid (Risedronate) is a pyridinyl biphosphonate which inhibits osteoclast-mediated bone resorption[1][2]. |
| Name | 1-hydroxy-2-([2,4,5,6-2H4]-pyridin-3-yl)ethylidene-1,1-bisphosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Risedronic acid-d4 (Risedronate-d4) is the deuterium labeled Risedronic acid. Risedronic acid (Risedronate) is a pyridinyl biphosphonate which inhibits osteoclast-mediated bone resorption[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C7H7D4NO7P2 |
|---|---|
| Molecular Weight | 287.13700 |
| Exact Mass | 287.02600 |
| PSA | 167.80000 |
| InChIKey | IIDJRNMFWXDHID-RZIJKAHPSA-N |
| SMILES | O=P(O)(O)C(O)(Cc1cccnc1)P(=O)(O)O |
| risedronic acid-d4 |
| Risedronic acid-d4 |