(4-chlorophenyl)sulfanylmethyl-trimethylsilane structure
|
Common Name | (4-chlorophenyl)sulfanylmethyl-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 112474-70-1 | Molecular Weight | 230.83000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15ClSSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-chlorophenyl)sulfanylmethyl-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15ClSSi |
|---|---|
| Molecular Weight | 230.83000 |
| Exact Mass | 230.03500 |
| PSA | 25.30000 |
| LogP | 4.72780 |
| InChIKey | HGTANISCBGMWQD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CSc1ccc(Cl)cc1 |
|
~96%
(4-chlorophenyl... CAS#:112474-70-1 |
| Literature: Ishibashi, Hiroyuki; Nakatani, Hiroshi; Umei, Yoshizumi; Yamamoto, Wako; Ikeda, Masazumi Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 589 - 594 |
| Silane,[[(4-chlorophenyl)thio]methyl]trimethyl |
| <(4-chlorophenylthio)methyl>trimethylsilane |