Benzenemethanamine,4-nitro-N-phenyl
Benzenemethanamine,4-nitro-N-phenyl structure
|
Common Name | Benzenemethanamine,4-nitro-N-phenyl | ||
|---|---|---|---|---|
| CAS Number | 10359-18-9 | Molecular Weight | 228.24700 | |
| Density | 1.258g/cm3 | Boiling Point | 401ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.3ºC | |
Summary: N-[(4-nitrophenyl)methyl]aniline (Chinese name: N-[(4-硝基苯基)甲基]安替比林)，CAS number: 10359-18-9，molecular formula: C13H12N2O2，molecular weight: 228.24700。For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[(4-nitrophenyl)methyl]aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 401ºC at 760 mmHg |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.24700 |
| Flash Point | 196.3ºC |
| Exact Mass | 228.09000 |
| PSA | 57.85000 |
| LogP | 3.80310 |
| Vapour Pressure | 1.22E-06mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | BFPIOTHCNQDBNL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CNc2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 7 | |
CAS#:555-16-8![Benzenamine,N-[(4-nitrophenyl)methylene] Structure](https://image.chemsrc.com/caspic/320/785-80-8.png)
CAS#:785-80-8
CAS#:619-73-8
CAS#:100-14-1
CAS#:103-70-8
CAS#:881-67-4
CAS#:2325-27-1
CAS#:1614-00-2
CAS#:873-76-7
CAS#:19795-97-2
CAS#:24007-66-7
CAS#:556-18-3
CAS#:467-62-9
CAS#:3682-71-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-(4-nitrophenylmethyl)aniline |
| N-phenyl-4-nitrobenzylamine |
| 4-Nitro-N-phenylbenzenemethanamine |
| 4-nitro-N-phenylbenzylamine |
| N-(4-nitrobenzyl)-aniline |
| p-NO2C6H4CH2NHPh |
| N-(4-nitrobenzyl)benzenamine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-[(4-nitrophenyl)methyl]aniline? |
| A: CAS number of N-[(4-nitrophenyl)methyl]aniline is 10359-18-9. |
| Q: What is the Chinese name of 10359-18-9? |
| A: Chinese name of 10359-18-9 is 10359-18-9. |
| Q: What is the boiling point of N-[(4-nitrophenyl)methyl]aniline? |
| A: Boiling point of N-[(4-nitrophenyl)methyl]aniline is 401ºC at 760 mmHg. |
| Q: What are the downstream products of N-[(4-nitrophenyl)methyl]aniline? |
| A: Related downstream products(CAS) of N-[(4-nitrophenyl)methyl]aniline: 19795-97-2;555-16-8;785-80-8;24007-66-7;556-18-3;467-62-9;3682-71-1. |
| Q: What are the upstream materials of N-[(4-nitrophenyl)methyl]aniline? |
| A: Related upstream materials(CAS) of N-[(4-nitrophenyl)methyl]aniline: 555-16-8;785-80-8;619-73-8;100-14-1;103-70-8;881-67-4;2325-27-1;1614-00-2;873-76-7. |
| Q: What is the SMILES notation of N-[(4-nitrophenyl)methyl]aniline? |
| A: SMILES notation of N-[(4-nitrophenyl)methyl]aniline is O=[N+]([O-])c1ccc(CNc2ccccc2)cc1. |
| Q: What is the molecular formula of N-[(4-nitrophenyl)methyl]aniline? |
| A: Molecular formula of N-[(4-nitrophenyl)methyl]aniline is C13H12N2O2. |
| Q: What is the molecular weight of N-[(4-nitrophenyl)methyl]aniline? |
| A: Molecular weight of N-[(4-nitrophenyl)methyl]aniline is 228.24700. |
| Q: What is the polar surface area (PSA) of N-[(4-nitrophenyl)methyl]aniline? |
| A: Polar surface area (PSA) of N-[(4-nitrophenyl)methyl]aniline is 57.85000. |
| Q: What English synonyms does N-[(4-nitrophenyl)methyl]aniline have? |
| A: English synonyms of N-[(4-nitrophenyl)methyl]aniline: N-(4-nitrophenylmethyl)aniline, N-phenyl-4-nitrobenzylamine, 4-Nitro-N-phenylbenzenemethanamine, 4-nitro-N-phenylbenzylamine, N-(4-nitrobenzyl)-aniline, p-NO2C6H4CH2NHPh, N-(4-nitrobenzyl)benzenamine. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |