2-(naphthalen-1-ylmethylidene)butanedioic acid structure
|
Common Name | 2-(naphthalen-1-ylmethylidene)butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 103632-74-2 | Molecular Weight | 256.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(naphthalen-1-ylmethylidene)butanedioic acid |
|---|
| Molecular Formula | C15H12O4 |
|---|---|
| Molecular Weight | 256.25300 |
| Exact Mass | 256.07400 |
| PSA | 74.60000 |
| LogP | 2.78250 |
| InChIKey | OCEJTXWZGWBSPX-WQLSENKSSA-N |
| SMILES | O=C(O)CC(=Cc1cccc2ccccc12)C(=O)O |
|
~%
2-(naphthalen-1... CAS#:103632-74-2 |
| Literature: Kissei Pharmaceutical Co Ltd Patent: EP200406 A3, 1988 ; |
|
~%
2-(naphthalen-1... CAS#:103632-74-2 |
| Literature: Awad, William I.; Kandile, Nadia G.; Wassef, Wasfy N.; Mohamed, Mansoura I. Journal fuer Praktische Chemie (Leipzig), 1989 , vol. 331, # 3 p. 405 - 410 |
|
~%
2-(naphthalen-1... CAS#:103632-74-2 |
| Literature: Abdallah, Shadia Mahmoud Journal of the Chemical Society of Pakistan, 2012 , vol. 34, # 2 p. 455 - 459 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |