diethyl 2-(naphthalen-1-ylmethylidene)propanedioate structure
|
Common Name | diethyl 2-(naphthalen-1-ylmethylidene)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 52505-38-1 | Molecular Weight | 298.33300 | |
| Density | 1.175g/cm3 | Boiling Point | 407.3ºC at 760 mmHg | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200ºC | |
| Name | diethyl 2-(naphthalen-1-ylmethylidene)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 407.3ºC at 760 mmHg |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.33300 |
| Flash Point | 200ºC |
| Exact Mass | 298.12100 |
| PSA | 52.60000 |
| LogP | 3.34940 |
| Index of Refraction | 1.597 |
| InChIKey | AFBQSUUVVNVVTR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=Cc1cccc2ccccc12)C(=O)OCC |
|
~90%
diethyl 2-(naph... CAS#:52505-38-1 |
| Literature: Iizuka; Kamijo; Harada; Akahane; Kubota; Etoh; Shimaoka; Tsubaki; Murakami; Yamaguchi; Iyobe; Umeyama; Kiso Chemical and Pharmaceutical Bulletin, 1990 , vol. 38, # 9 p. 2487 - 2493 |
|
~%
diethyl 2-(naph... CAS#:52505-38-1 |
| Literature: Nabar,D.P.; Sunthankar,S.V. Bulletin of the Chemical Society of Japan, 1969 , vol. 42, p. 2991 - 2993 |
| diethyl (naphthalen-1-ylmethylidene)propanedioate |