Quinapril Diketopiperazine structure
|
Common Name | Quinapril Diketopiperazine | ||
|---|---|---|---|---|
| CAS Number | 103733-49-9 | Molecular Weight | 420.50 | |
| Density | 1.25g/cm3 | Boiling Point | 644.5ºC at 760 mmHg | |
| Molecular Formula | C25H28N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.6ºC | |
Use of Quinapril DiketopiperazinePD 109488 is a quinapril diketopiperazine metabolite[1]. |
| Name | Quinapril Diketopiperazine |
|---|---|
| Synonym | More Synonyms |
| Description | PD 109488 is a quinapril diketopiperazine metabolite[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 644.5ºC at 760 mmHg |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.50 |
| Flash Point | 343.6ºC |
| Exact Mass | 420.20500 |
| PSA | 66.92000 |
| LogP | 2.61090 |
| Vapour Pressure | 1.68E-16mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | NDDYKENLGBOEPD-HSQYWUDLSA-N |
| SMILES | CCOC(=O)C(CCc1ccccc1)N1C(=O)C2Cc3ccccc3CN2C(=O)C1C |
| RIDADR | NONH for all modes of transport |
|---|
| ethyl (2S)-2-[(3S,11aS)-3-methyl-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-4-phenylbutanoate |