p-Toluenesulfonylsemicarbazide structure
|
Common Name | p-Toluenesulfonylsemicarbazide | ||
|---|---|---|---|---|
| CAS Number | 10396-10-8 | Molecular Weight | 229.256 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H11N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | p-Toluenesulfonylsemicarbazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.256 |
| Exact Mass | 229.052109 |
| PSA | 109.67000 |
| LogP | 0.18 |
| Index of Refraction | 1.588 |
| InChIKey | VRFNYSYURHAPFL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NNC(N)=O)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2935009090 |
|
~85%
p-Toluenesulfon... CAS#:10396-10-8 |
| Literature: Safaei-Ghomi, Javad Journal of the Chinese Chemical Society, 2007 , vol. 54, # 6 p. 1561 - 1563 |
|
~%
p-Toluenesulfon... CAS#:10396-10-8 |
| Literature: Journal of Organic Chemistry, , vol. 41, p. 116 - 122 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2-[(4-Methylphenyl)sulfonyl]hydrazinecarboxamide |
| MFCD00072243 |
| Benzenesulfonic acid, 4-methyl-, 2-(aminocarbonyl)hydrazide |
| [(4-methylphenyl)sulfonylamino]urea |
| EINECS 233-857-6 |