Ethyl 3-[4-(benzyloxy)phenyl]acrylate structure
|
Common Name | Ethyl 3-[4-(benzyloxy)phenyl]acrylate | ||
|---|---|---|---|---|
| CAS Number | 104315-07-3 | Molecular Weight | 282.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 3-[4-(benzyloxy)phenyl]acrylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H18O3 |
|---|---|
| Molecular Weight | 282.33400 |
| Exact Mass | 282.12600 |
| PSA | 35.53000 |
| LogP | 3.84190 |
| InChIKey | IWYBNMQBSPKPRB-JLHYYAGUSA-N |
| SMILES | CCOC(=O)C=Cc1ccc(OCc2ccccc2)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (E)-ethyl 3-(4-(benzyloxy)phenyl)acrylate |
| ethyl (E)-3-(4-benzyloxy-phenyl)-acrylate |
| (E)-ethyl 3-(benzo[d][1,3]dioxol-5-yl)acrylate |
| trans-ethyl-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| (E)-1,3-Benzodioxole-5-acrylic acid ethyl ester |
| ethyl (E)-3-(4-(benzyloxy)phenyl)-2-propanoate |
| (E)-ethyl 3-(benzo[d][1,3]dioxol-6-yl)acrylate |
| (E)-3-(4-benzyloxyphenyl)acrylicacid ethyl ester |
| (2E)-3-[4-(Phenylmethoxy)phenyl]-2-propenoic Acid Ethyl Ester |
| ethyl (E)-(4-benzyloxy)cinnamate |
| ethyl (2E)-3-[(3,4-methylenedioxy)phenyl]prop-2-enoate |
| 4-benzyloxycinnamic acid ethyl ester |
| ethyl 3-(3',4'-methylenedioxyphenyl)prop-2-enoate |
| ethyl 3-[(3',4'-methylenedioxy)phenyl]propenoate |
| (E)-3-(1,3-Benzodioxol-5-yl)propenoic acid ethyl ester |
| trans-1-carboxyethyl-2-(3',4'-methylenedioxyphenyl)ethene |
| ethyl (2E)-3-[4-(benzyloxy)phenyl]prop-2-enoate |
| (E)-3-(1,3-Benzodioxole-5-yl)acrylic acid ethyl ester |