Ethyl 4-hydroxy-2-nitrobenzoate structure
|
Common Name | Ethyl 4-hydroxy-2-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 104356-27-6 | Molecular Weight | 211.171 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 349.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.3±23.7 °C | |
| Name | Ethyl 4-hydroxy-2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 349.7±27.0 °C at 760 mmHg |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.171 |
| Flash Point | 165.3±23.7 °C |
| Exact Mass | 211.048065 |
| PSA | 92.35000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | GHUFFYRUAHAHQQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(O)cc1[N+](=O)[O-] |
| HS Code | 2918290000 |
|---|
|
~%
Ethyl 4-hydroxy... CAS#:104356-27-6 |
| Literature: US6143208 A1, ; |
|
~%
Ethyl 4-hydroxy... CAS#:104356-27-6 |
| Literature: Journal of the Chemical Society, , p. 1498,1502 |
|
~%
Ethyl 4-hydroxy... CAS#:104356-27-6 |
| Literature: Journal of the Chemical Society, , p. 1498,1502 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 4-hydroxy-2-nitro-, ethyl ester |
| 4-Hydroxy-2-nitro-benzoic acid ethyl ester |
| Ethyl 4-hydroxy-2-nitrobenzoate |
| 4-Hydroxy-2-nitro-benzoic acid ethylester |