Ethyl 2-piperazin-1-yl-thiazole-4-carboxylate structure
|
Common Name | Ethyl 2-piperazin-1-yl-thiazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 104481-24-5 | Molecular Weight | 241.310 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 378.4±52.0 °C at 760 mmHg | |
| Molecular Formula | C10H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.6±30.7 °C | |
| Name | Ethyl 2-piperazin-1-yl-thiazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.4±52.0 °C at 760 mmHg |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.310 |
| Flash Point | 182.6±30.7 °C |
| Exact Mass | 241.088501 |
| PSA | 82.70000 |
| LogP | 0.31 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | NNFAICXZOSXKDP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1csc(N2CCNCC2)n1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
|
~%
Ethyl 2-piperaz... CAS#:104481-24-5 |
| Literature: US2007/112011 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Ethyl 2-(1-piperazinyl)-1,3-thiazole-4-carboxylate |
| 4-Thiazolecarboxylic acid, 2-(1-piperazinyl)-, ethyl ester |
| ethyl 2-piperazin-1-yl-1,3-thiazole-4-carboxylate |
| Ethyl 2-(piperazin-1-yl)-1,3-thiazole-4-carboxylate |
| 2-(1-Piperazinyl)-4-thiazolecarboxylic acid ethyl ester |