EC-23 structure
|
Common Name | EC-23 | ||
|---|---|---|---|---|
| CAS Number | 104561-41-3 | Molecular Weight | 332.435 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 484.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C23H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.8±23.4 °C | |
Use of EC-23EC23 (AGN 190205) is a stable synthetic retinoid analogue and induces neuronal differentiation[1]. |
| Name | 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | EC23 (AGN 190205) is a stable synthetic retinoid analogue and induces neuronal differentiation[1]. |
|---|---|
| Related Catalog | |
| In Vitro | EC23 (AGN 190205) induces neural differentiation accompanying by elevated levels of stathmin and profilin-1. EC23 induces the expression of known cellular retinoid binding proteins in the TERA2.cl.SP12 cell line[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 484.7±45.0 °C at 760 mmHg |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.435 |
| Flash Point | 225.8±23.4 °C |
| Exact Mass | 332.177643 |
| PSA | 37.30000 |
| LogP | 8.21 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | OQVLOWLEEHYBJH-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(C)(C)c2cc(C#Cc3ccc(C(=O)O)cc3)ccc21 |
| 4-[(5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenyl)ethynyl]benzoic acid |
| 4-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-ylethynyl)benzoic acid |
| Benzoic acid, 4-[2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenyl)ethynyl]- |
| ec 23 |