(1,4-dimethyl-5-nitroimidazol-2-yl)methyl carbamate structure
|
Common Name | (1,4-dimethyl-5-nitroimidazol-2-yl)methyl carbamate | ||
|---|---|---|---|---|
| CAS Number | 104575-24-8 | Molecular Weight | 214.17900 | |
| Density | 1.56g/cm3 | Boiling Point | 492ºC at 760mmHg | |
| Molecular Formula | C7H10N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.3ºC | |
| Name | (1,4-dimethyl-5-nitroimidazol-2-yl)methyl carbamate |
|---|
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 492ºC at 760mmHg |
| Molecular Formula | C7H10N4O4 |
| Molecular Weight | 214.17900 |
| Flash Point | 251.3ºC |
| Exact Mass | 214.07000 |
| PSA | 116.95000 |
| LogP | 1.26900 |
| Vapour Pressure | 8E-10mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | SYBXQTPZWDYKLN-UHFFFAOYSA-N |
| SMILES | Cc1nc(COC(N)=O)n(C)c1[N+](=O)[O-] |
|
~45%
(1,4-dimethyl-5... CAS#:104575-24-8 |
| Literature: Walsh; Wang; Bagan; Wislocki; Miwa Journal of Medicinal Chemistry, 1987 , vol. 30, # 1 p. 150 - 156 |
|
~%
(1,4-dimethyl-5... CAS#:104575-24-8 |
| Literature: Walsh; Wang; Bagan; Wislocki; Miwa Journal of Medicinal Chemistry, 1987 , vol. 30, # 1 p. 150 - 156 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |