N-[(3-nitrophenyl)methyl]-2-phenylethanamine structure
|
Common Name | N-[(3-nitrophenyl)methyl]-2-phenylethanamine | ||
|---|---|---|---|---|
| CAS Number | 104720-70-9 | Molecular Weight | 256.30000 | |
| Density | 1.164g/cm3 | Boiling Point | 411.7ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.8ºC | |
| Name | N-[(3-nitrophenyl)methyl]-2-phenylethanamine |
|---|
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 411.7ºC at 760 mmHg |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Flash Point | 202.8ºC |
| Exact Mass | 256.12100 |
| PSA | 57.85000 |
| LogP | 3.84120 |
| Vapour Pressure | 5.47E-07mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | LLMBTUCGGDSIQU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(CNCCc2ccccc2)c1 |
| HS Code | 2921499090 |
|---|
|
~93%
N-[(3-nitrophen... CAS#:104720-70-9 |
| Literature: Chugai Seiyaku Kabushiki Kaisha Patent: US6534546 B1, 2003 ; |
|
~%
N-[(3-nitrophen... CAS#:104720-70-9 |
| Literature: ADAMED SP. Z O.O.; KOŁACZKOWSKI, Marcin; MARCINKOWSKA, Monika; BUCKI, Adam; ŁYSAKOWSKI, Tomasz; PAWŁOWSKI, Maciej Patent: WO2013/140347 A1, 2013 ; Location in patent: Page/Page column 33 ; |
|
~%
N-[(3-nitrophen... CAS#:104720-70-9 |
| Literature: ADAMED SP. Z O.O.; KOŁACZKOWSKI, Marcin; MARCINKOWSKA, Monika; BUCKI, Adam; ŁYSAKOWSKI, Tomasz; PAWŁOWSKI, Maciej Patent: WO2013/140347 A1, 2013 ; |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |