2-Naphthyl methacrylate structure
|
Common Name | 2-Naphthyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 10475-46-4 | Molecular Weight | 212.24400 | |
| Density | 1.122g/cm3 | Boiling Point | 357.4ºC at 760mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | 62-64ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 149.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | naphthalen-2-yl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 357.4ºC at 760mmHg |
| Melting Point | 62-64ºC(lit.) |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | 149.2ºC |
| Exact Mass | 212.08400 |
| PSA | 26.30000 |
| LogP | 3.32130 |
| Vapour Pressure | 2.74E-05mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | CXOYJPWMGYDJNW-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)Oc1ccc2ccccc2c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2916140000 |
|
~84%
2-Naphthyl meth... CAS#:10475-46-4 |
| Literature: Spectrochimica Acta - Part A: Molecular and Biomolecular Spectroscopy, , vol. 61, # 11-12 p. 2505 - 2509 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| Methacrylsaeure-[2]naphthylester |
| methacrylic acid-[2]naphthyl ester |
| MFCD00080581 |
| EINECS 233-967-4 |
| 2-Naphthyl methacrylate |