H-D-Ala-Leu-Lys-AMC hydrochloride salt structure
|
Common Name | H-D-Ala-Leu-Lys-AMC hydrochloride salt | ||
|---|---|---|---|---|
| CAS Number | 104881-72-3 | Molecular Weight | 487.59200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H37N5O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | D-Ala-Leu-Lys-7-amido-4-methylcoumarin |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H37N5O5 |
|---|---|
| Molecular Weight | 487.59200 |
| Exact Mass | 487.27900 |
| PSA | 169.55000 |
| LogP | 3.78720 |
| InChIKey | FHYIXLQAMONDNN-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C(CCCCN)NC(=O)C(CC(C)C)NC(=O)C(C)N)ccc12 |
| RIDADR | NONH for all modes of transport |
|---|
|
Direct photometric or fluorometric assay of proteinases using substrates containing 7-amino-4-trifluoromethylcoumarin.
Thromb. Res. 17 , 393, (1980)
|
| 6-amino-2-[[2-(2-aminopropanoylamino)-4-methylpentanoyl]amino]-N-(4-methyl-2-oxochromen-7-yl)hexanamide |
| H-D-ALA-LEU-LYS-AMC |