H-Lys-Pro-AMC hydrochloride salt structure
|
Common Name | H-Lys-Pro-AMC hydrochloride salt | ||
|---|---|---|---|---|
| CAS Number | 133066-53-2 | Molecular Weight | 400.47 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 705.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C21H28N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 380.6±32.9 °C | |
Use of H-Lys-Pro-AMC hydrochloride saltLys-Pro-AMC is a fluorogenic substrate for the detection and measurement of the activity of specific enzymes[1]. |
| Name | L-Lysyl-N-(4-methyl-2-oxo-2H-chromen-7-yl)-L-prolinamide |
|---|---|
| Synonym | More Synonyms |
| Description | Lys-Pro-AMC is a fluorogenic substrate for the detection and measurement of the activity of specific enzymes[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 705.6±60.0 °C at 760 mmHg |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.47 |
| Flash Point | 380.6±32.9 °C |
| Exact Mass | 400.211060 |
| LogP | 0.57 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | NSYORZKUSRQUFF-IRXDYDNUSA-N |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C3CCCN3C(=O)C(N)CCCCN)ccc12 |
| L-Prolinamide, L-lysyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)- |
| L-Lysyl-N-(4-methyl-2-oxo-2H-chromen-7-yl)-L-prolinamide |
| H-Lys-Pro-AMC hydrochloride salt |