2-Propen-1-one,3-(3,4-dimethoxyphenyl)-1-(2-hydroxy-4-methoxyphenyl)- structure
|
Common Name | 2-Propen-1-one,3-(3,4-dimethoxyphenyl)-1-(2-hydroxy-4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 10493-06-8 | Molecular Weight | 314.33300 | |
| Density | 1.207g/cm3 | Boiling Point | 518.9ºC at 760 mmHg | |
| Molecular Formula | C18H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.7ºC | |
| Name | 2'-hydroxy-3,4,4'-trimethoxychalcone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 518.9ºC at 760 mmHg |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.33300 |
| Flash Point | 188.7ºC |
| Exact Mass | 314.11500 |
| PSA | 64.99000 |
| LogP | 3.31410 |
| Vapour Pressure | 2.19E-11mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | SKTAHPCCLORHHM-XBXARRHUSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2ccc(OC)c(OC)c2)c(O)c1 |
| HS Code | 2914509090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2'-Hydroxy-3,4,4'-trimethoxy-trans-chalkon |
| 2-Hydroxy-3',4,4',5'-tetramethoxybenzophenon |
| 2'-hydroxy-3,4,4'-trimethoxy-chalcone |
| 2'-hydroxy-4,3,4'-trimethoxychalcone |
| 3,4,4',5'-tetramethoxy-2'-hydroxybenzophenone |
| 2'-hydroxy-3,4,4'-trimethoxy-trans-chalcone |