3',4',7-trimethoxyflavone structure
|
Common Name | 3',4',7-trimethoxyflavone | ||
|---|---|---|---|---|
| CAS Number | 22395-24-0 | Molecular Weight | 312.31700 | |
| Density | 1.242g/cm3 | Boiling Point | 477.4ºC at 760mmHg | |
| Molecular Formula | C18H16O5 | Melting Point | 179-181ºC | |
| MSDS | N/A | Flash Point | 212ºC | |
| Name | 2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 477.4ºC at 760mmHg |
| Melting Point | 179-181ºC |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.31700 |
| Flash Point | 212ºC |
| Exact Mass | 312.10000 |
| PSA | 57.90000 |
| LogP | 3.48580 |
| Vapour Pressure | 2.81E-09mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | VSFZYCDPDWSYSS-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(=O)cc(-c3ccc(OC)c(OC)c3)oc2c1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 7,3',4'-Trimethoxyflavone |
| 3',4',7-trimethoxyflavone |
| 7,3',4'-tri-O-methylfisetin |