1-[3-(4-chlorophenyl)-1-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]pyridin-2-one structure
|
Common Name | 1-[3-(4-chlorophenyl)-1-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 104941-02-8 | Molecular Weight | 353.77400 | |
| Density | 1.366g/cm3 | Boiling Point | 544.2ºC at 760mmHg | |
| Molecular Formula | C20H13ClFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.9ºC | |
| Name | 1-[3-(4-chlorophenyl)-1-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]pyridin-2-one |
|---|
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 544.2ºC at 760mmHg |
| Molecular Formula | C20H13ClFNO2 |
| Molecular Weight | 353.77400 |
| Flash Point | 282.9ºC |
| Exact Mass | 353.06200 |
| PSA | 39.07000 |
| LogP | 4.52180 |
| Vapour Pressure | 6.67E-12mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | BWYZZCATCCVPLI-AQTBWJFISA-N |
| SMILES | O=C(C(=Cc1ccc(F)cc1)n1ccccc1=O)c1ccc(Cl)cc1 |
|
~74%
1-[3-(4-chlorop... CAS#:104941-02-8 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
1-[3-(4-chlorop... CAS#:104941-02-8 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |
|
~%
1-[3-(4-chlorop... CAS#:104941-02-8 |
| Literature: Ogata, Masaru; Matsumoto, Hiroshi; Kida, Shiro; Shimizu, Sumio; Tawara, Katsuya; Kawamura, Yoshimi Journal of Medicinal Chemistry, 1987 , vol. 30, # 8 p. 1497 - 1502 |