1,3-BIS(3-AMINOPHENOXY)BENZENE structure
|
Common Name | 1,3-BIS(3-AMINOPHENOXY)BENZENE | ||
|---|---|---|---|---|
| CAS Number | 10526-07-5 | Molecular Weight | 292.332 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 479.9±30.0 °C at 760 mmHg | |
| Molecular Formula | C18H16N2O2 | Melting Point | 108°C | |
| MSDS | N/A | Flash Point | 264.8±18.2 °C | |
| Name | 1,3-Bis(3-Aminophenoxy)Benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 479.9±30.0 °C at 760 mmHg |
| Melting Point | 108°C |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.332 |
| Flash Point | 264.8±18.2 °C |
| Exact Mass | 292.121185 |
| PSA | 70.50000 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | DKKYOQYISDAQER-UHFFFAOYSA-N |
| SMILES | Nc1cccc(Oc2cccc(Oc3cccc(N)c3)c2)c1 |
| Risk Phrases | R20/21/22 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2922299090 |
|
~%
1,3-BIS(3-AMINO... CAS#:10526-07-5 |
| Literature: Helvetica Chimica Acta, , vol. 51, p. 954 - 974 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,3'-[1,3-Phenylenebis(oxy)]dianiline |
| 3,3'-(1,3-Phenylenebis(oxy))dianiline |
| 1,3-Phenylenebis(3-oxyaniline) |
| 3,3'-(M-PHENYLENEDIOXY)DIANILINE |
| 3-[3-(3-aminophenoxy)phenoxy]aniline |
| Resorcinol Bis(3-aminophenyl) Ether |
| 1,3-BIS(3-AMINOPHENOXY)BENZENE |
| MFCD00043718 |
| Benzenamine, 3,3'-[1,3-phenylenebis(oxy)]bis- |
| EINECS 234-082-6 |
| Benzenamine, 3,3'-(1,3-phenylenebis(oxy))bis- |
| 3,3'-(m-Phenylenebis(oxy))dianiline |