1,5-Dicyclohexyl-3-phenylbarbituric acid structure
|
Common Name | 1,5-Dicyclohexyl-3-phenylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 1053-49-2 | Molecular Weight | 368.46900 | |
| Density | 1.218g/cm3 | Boiling Point | 496.4ºC at 760 mmHg | |
| Molecular Formula | C22H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.2ºC | |
| Name | 1,5-dicyclohexyl-3-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 496.4ºC at 760 mmHg |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.46900 |
| Flash Point | 204.2ºC |
| Exact Mass | 368.21000 |
| PSA | 57.69000 |
| LogP | 4.51390 |
| Vapour Pressure | 5.42E-10mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | MSVVAFKSLYXQNS-UHFFFAOYSA-N |
| SMILES | O=C1C(C2CCCCC2)C(=O)N(C2CCCCC2)C(=O)N1c1ccccc1 |
| HS Code | 2933540000 |
|---|
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,5-dicyclohexyl-3-phenyl-pyrimidine-2,4,6-trione |
| 1-Phenyl-3,5-dicyclohexyl-barbitursaeure |
| 1,5-Dicyclohexyl-3-phenylbarbituric acid |
| BARBITURIC ACID,1,5-DICYCLOHEXYL-3-PHENYL |