Methanone,(4-chlorophenyl)(4-methoxyphenyl)- structure
|
Common Name | Methanone,(4-chlorophenyl)(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 10547-60-1 | Molecular Weight | 246.68900 | |
| Density | 1.212g/cm3 | Boiling Point | 380.5ºC at 760mmHg | |
| Molecular Formula | C14H11ClO2 | Melting Point | 124-125 °C(Predicted) | |
| MSDS | N/A | Flash Point | 157.6ºC | |
| Name | (4-chlorophenyl)-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 380.5ºC at 760mmHg |
| Melting Point | 124-125 °C(Predicted) |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.68900 |
| Flash Point | 157.6ºC |
| Exact Mass | 246.04500 |
| PSA | 26.30000 |
| LogP | 3.57960 |
| Vapour Pressure | 5.42E-06mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | JJVJYPSXZCEIEQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2914700090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-methoxy-4'-chlorobenzophenone |
| p-anisyl p-chlorophenyl ketone |
| 4-Chloro-4'-methoxybenzophenone |
| p-Anisophenone,4'-chloro |