phenylthiohydantoin-glutamine structure
|
Common Name | phenylthiohydantoin-glutamine | ||
|---|---|---|---|---|
| CAS Number | 10567-86-9 | Molecular Weight | 263.31600 | |
| Density | 1.4g/cm3 | Boiling Point | 476.7ºC at 760 mmHg | |
| Molecular Formula | C12H13N3O2S | Melting Point | 205ºC | |
| MSDS | N/A | Flash Point | 242.1ºC | |
| Name | 3-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 476.7ºC at 760 mmHg |
| Melting Point | 205ºC |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.31600 |
| Flash Point | 242.1ºC |
| Exact Mass | 263.07300 |
| PSA | 107.52000 |
| LogP | 1.63590 |
| Vapour Pressure | 2.99E-09mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | UNCINZHSIAEDPO-UHFFFAOYSA-N |
| SMILES | NC(=O)CCC1NC(=S)N(c2ccccc2)C1=O |
| Storage condition | −20°C |
|
~%
phenylthiohydan... CAS#:10567-86-9 |
| Literature: Acta Chemica Scandinavica (1947-1973), , vol. 10, p. 466 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Imidazolidinepropanamide,5-oxo-1-phenyl-2-thioxo |
| Glutamin-PTH |
| 3-(5-Oxo-1-phenyl-2-thioxo-imidazolidin-4-yl)-propionsaeure-amid |
| Pth-glutamine |
| 3-(5-oxo-1-phenyl-2-thioxo-imidazolidin-4-yl)-propionic acid amide |
| D,L-glutamine N-phenylthiohydantoin |
| 3-(5-oxo-1-phenyl-2-thioxo-imidazolidin-4-yl)-propionamide |
| EINECS 234-153-1 |
| Glutamin-phenyl-thiohydantoin |