O-hexyl furan-2-carbonylsulfanylmethanethioate structure
|
Common Name | O-hexyl furan-2-carbonylsulfanylmethanethioate | ||
|---|---|---|---|---|
| CAS Number | 105770-08-9 | Molecular Weight | 272.38400 | |
| Density | 1.194g/cm3 | Boiling Point | 357.2ºC at 760mmHg | |
| Molecular Formula | C12H16O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8ºC | |
| Name | O-hexyl furan-2-carbonylsulfanylmethanethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 357.2ºC at 760mmHg |
| Molecular Formula | C12H16O3S2 |
| Molecular Weight | 272.38400 |
| Flash Point | 169.8ºC |
| Exact Mass | 272.05400 |
| PSA | 96.83000 |
| LogP | 4.03480 |
| Vapour Pressure | 2.78E-05mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | LBPZWBIDFFVKNN-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=S)SC(=O)c1ccco1 |
| 2-Furancarbothioic acid,anhydrosulfide with O-hexyl hydrogen carbonodithioate |
| Carbonic acid,dithio-,anhydrosulfide with thio-2-furoic acid,O-hexyl ester |