O-decyl furan-2-carbonylsulfanylmethanethioate structure
|
Common Name | O-decyl furan-2-carbonylsulfanylmethanethioate | ||
|---|---|---|---|---|
| CAS Number | 105770-10-3 | Molecular Weight | 328.49000 | |
| Density | 1.116g/cm3 | Boiling Point | 413.7ºC at 760 mmHg | |
| Molecular Formula | C16H24O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204ºC | |
| Name | O-decyl furan-2-carbonylsulfanylmethanethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 413.7ºC at 760 mmHg |
| Molecular Formula | C16H24O3S2 |
| Molecular Weight | 328.49000 |
| Flash Point | 204ºC |
| Exact Mass | 328.11700 |
| PSA | 96.83000 |
| LogP | 5.59520 |
| Vapour Pressure | 4.72E-07mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | GKUOTIJEAHWWMD-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC(=S)SC(=O)c1ccco1 |
| Carbonic acid,dithio-,anhydrosulfide with thio-2-furoic acid,O-decyl ester |
| 2-Furancarbothioic acid,anhydrosulfide with O-decyl hydrogen carbonodithioate |