Stannane,(2,3,4,5,6-pentafluorophenyl)triphenyl- structure
|
Common Name | Stannane,(2,3,4,5,6-pentafluorophenyl)triphenyl- | ||
|---|---|---|---|---|
| CAS Number | 1058-08-8 | Molecular Weight | 517.06900 | |
| Density | N/A | Boiling Point | 468.3ºC at 760mmHg | |
| Molecular Formula | C24H15F5Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237ºC | |
| Name | (2,3,4,5,6-pentafluorophenyl)-triphenylstannane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 468.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C24H15F5Sn |
| Molecular Weight | 517.06900 |
| Flash Point | 237ºC |
| Exact Mass | 518.01200 |
| LogP | 3.75950 |
| Vapour Pressure | 1.7E-08mmHg at 25°C |
| InChIKey | BGRCBDJIQNGVFO-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c([Sn](c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c1F |
| HS Code | 2931900090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (pentafluorophenyl)(triphenyl)stannane |
| Triphenyl-pentafluorphenyl-stannan |
| Stannane,(pentafluorophenyl)triphenyl |
| pentafluorophenyltriphenyltin |