Stannane,tetrakis(pentafluorophenyl)- (8CI,9CI) structure
|
Common Name | Stannane,tetrakis(pentafluorophenyl)- (8CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 1065-49-2 | Molecular Weight | 786.92600 | |
| Density | N/A | Boiling Point | 453.4ºC at 760mmHg | |
| Molecular Formula | C24F20Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228ºC | |
| Name | tetrakis(2,3,4,5,6-pentafluorophenyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 453.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C24F20Sn |
| Molecular Weight | 786.92600 |
| Flash Point | 228ºC |
| Exact Mass | 787.87000 |
| LogP | 5.84600 |
| Vapour Pressure | 5.59E-08mmHg at 25°C |
| InChIKey | KSBKVGFAMLUKFL-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c([Sn](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| tetra-perfluoro-phenyl tin |
| Perfluorotetraphenyltin |